![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 2011 xmas drink drive.bmp | 2016-08-12 15:20 | 851K | |
![[SND]](/icons/sound2.gif) | AAA.mp3 | 2016-08-12 15:21 | 235K | |
![[SND]](/icons/sound2.gif) | ALEX-EERACE.mp3 | 2016-08-12 15:21 | 270K | |
![[SND]](/icons/sound2.gif) | AUTISMCINEMA1.mp3 | 2016-08-12 15:21 | 423K | |
![[SND]](/icons/sound2.gif) | Alf Cannan Fund .mp3 | 2016-08-12 15:21 | 256K | |
![[SND]](/icons/sound2.gif) | Anderson breast.mp3 | 2016-08-12 15:21 | 472K | |
![[IMG]](/icons/image2.gif) | Arizona Watterson.bmp | 2016-08-12 15:21 | 900K | |
![[ ]](/icons/unknown.gif) | BACityflyer | 2016-08-12 15:21 | 1.0M | |
![[SND]](/icons/sound2.gif) | BALL WATCHES 2.mp3 | 2016-08-12 15:21 | 138K | |
![[SND]](/icons/sound2.gif) | BEECROFT CARS 2.mp3 | 2016-08-12 15:21 | 138K | |
![[SND]](/icons/sound2.gif) | BELL DEPARTMENTAL 1 .mp3 | 2016-08-12 15:21 | 324K | |
![[SND]](/icons/sound2.gif) | BELL EVL 1 .mp3 | 2016-08-12 15:21 | 365K | |
![[SND]](/icons/sound2.gif) | BELL PORT SODERICK 2.mp3 | 2016-08-12 15:21 | 289K | |
![[SND]](/icons/sound2.gif) | BILLIONAIRE1.mp3 | 2016-08-12 15:21 | 544K | |
![[SND]](/icons/sound2.gif) | BRA DASH 2015 SAT.mp3 | 2016-08-12 15:21 | 363K | |
![[SND]](/icons/sound2.gif) | BRAIN TUMOUR YEMEN 2.mp3 | 2016-08-12 15:21 | 132K | |
![[SND]](/icons/sound2.gif) | BRITTON AMNESTY 2.mp3 | 2016-08-12 15:21 | 233K | |
![[SND]](/icons/sound2.gif) | BUDGETREACTION1.mp3 | 2016-08-12 15:21 | 422K | |
![[SND]](/icons/sound2.gif) | BUS-ALF2.mp3 | 2016-08-12 15:21 | 252K | |
![[IMG]](/icons/image2.gif) | Ballafletcher Road Braddan.bmp | 2016-08-12 15:21 | 1.2M | |
![[SND]](/icons/sound2.gif) | Bell sexy.mp3 | 2016-08-12 15:21 | 550K | |
![[IMG]](/icons/image2.gif) | Bethany Clague.bmp | 2016-08-12 15:21 | 156K | |
![[IMG]](/icons/image2.gif) | Bridge Road Douglas.bmp | 2016-08-12 15:21 | 868K | |
![[SND]](/icons/sound2.gif) | CARBON MONOXIDE MONDAY.mp3 | 2016-08-12 15:21 | 464K | |
![[SND]](/icons/sound2.gif) | CAT PETITION 1 .mp3 | 2016-08-12 15:21 | 232K | |
![[SND]](/icons/sound2.gif) | CHIEF CONSTABLE INCLUSION .mp3 | 2016-08-12 15:21 | 313K | |
![[SND]](/icons/sound2.gif) | CHILDREN'S UNI END 2.mp3 | 2016-08-12 15:21 | 231K | |
![[SND]](/icons/sound2.gif) | CHRIS LEE 1.mp3 | 2016-08-12 15:21 | 205K | |
![[SND]](/icons/sound2.gif) | CHRIS ROBERSHAW - (Imported).mp3 | 2016-08-12 15:21 | 377K | |
![[SND]](/icons/sound2.gif) | CON-HAND.mp3 | 2016-08-12 15:21 | 392K | |
![[SND]](/icons/sound2.gif) | CORBYN1.mp3 | 2016-08-12 15:21 | 476K | |
![[SND]](/icons/sound2.gif) | CORLETT1.mp3 | 2016-08-12 15:21 | 428K | |
![[SND]](/icons/sound2.gif) | COUNTRYSIDE 999 - MUST CREDIT BBC - 1 .mp3 | 2016-08-12 15:21 | 251K | |
![[SND]](/icons/sound2.gif) | CRAINE COURT LIST - (Imported).mp3 | 2016-08-12 15:21 | 217K | |
![[SND]](/icons/sound2.gif) | CREGEEN TV LICENCE STAND OFF 1.mp3 | 2016-08-12 15:21 | 243K | |
![[SND]](/icons/sound2.gif) | CULL1.mp3 | 2016-08-12 15:22 | 364K | |
![[IMG]](/icons/image2.gif) | CYG map.bmp | 2016-08-12 15:22 | 960K | |
![[ ]](/icons/layout.gif) | CYG road closures.pdf | 2016-08-12 15:22 | 3.0M | |
![[SND]](/icons/sound2.gif) | Chirs gregory.mp3 | 2016-08-12 15:22 | 4.6M | |
![[IMG]](/icons/image2.gif) | DAFF2.bmp | 2016-08-12 15:22 | 303K | |
![[SND]](/icons/sound2.gif) | DEREK BOMB 2.mp3 | 2016-08-12 15:22 | 243K | |
![[SND]](/icons/sound2.gif) | DIALYSIS GARVEY 2.mp3 | 2016-08-12 15:22 | 334K | |
![[SND]](/icons/sound2.gif) | DISABLEDPARKING1.mp3 | 2016-08-12 15:22 | 484K | |
![[SND]](/icons/sound2.gif) | DR KISH MUMPS .mp3 | 2016-08-12 15:22 | 518K | |
![[SND]](/icons/sound2.gif) | DRKISH RABIES 1.mp3 | 2016-08-12 15:22 | 347K | |
![[SND]](/icons/sound2.gif) | DUNLOP RAISE BAR 1.mp3 | 2016-08-12 15:22 | 284K | |
![[SND]](/icons/sound2.gif) | Dave Molyneux.mp3 | 2016-08-12 15:22 | 267K | |
![[SND]](/icons/sound2.gif) | ECSTASY1.mp3 | 2016-08-12 15:22 | 395K | |
![[SND]](/icons/sound2.gif) | EDWARDS DRINK DRIVE 1.mp3 | 2016-08-12 15:22 | 324K | |
![[SND]](/icons/sound2.gif) | ENGLAND STAB 1 .mp3 | 2016-08-12 15:22 | 416K | |
![[IMG]](/icons/image2.gif) | Eddie Lowey.bmp | 2016-08-12 15:22 | 122K | |
![[SND]](/icons/sound2.gif) | Eddie Lowey cut 1.mp3 | 2016-08-12 15:22 | 294K | |
![[SND]](/icons/sound2.gif) | F1-POWNALL - (Imported).mp3 | 2016-08-12 15:23 | 309K | |
![[SND]](/icons/sound2.gif) | FOSTERING FIRST FIONA.mp3 | 2016-08-12 15:23 | 467K | |
![[SND]](/icons/sound2.gif) | FRAMEWORK COST SAVING .mp3 | 2016-08-12 15:23 | 474K | |
![[SND]](/icons/sound2.gif) | FRI - RED CROSS.mp3 | 2016-08-12 15:23 | 375K | |
![[ ]](/icons/unknown.gif) | Fire in Agneash May 31st 2016 | 2016-08-12 15:23 | 126K | |
![[IMG]](/icons/image2.gif) | Fukushima radiation graph.bmp | 2016-08-12 15:23 | 2.8M | |
![[SND]](/icons/sound2.gif) | GAWNE WASTED 1.mp3 | 2016-08-12 15:23 | 357K | |
![[SND]](/icons/sound2.gif) | GAZA VOX.mp3 | 2016-08-12 15:23 | 444K | |
![[SND]](/icons/sound2.gif) | GCSECHANGES1.mp3 | 2016-08-12 15:23 | 399K | |
![[SND]](/icons/sound2.gif) | GCSE VOX.mp3 | 2016-08-12 15:23 | 332K | |
![[SND]](/icons/sound2.gif) | GEORGE Q.mp3 | 2016-08-12 15:23 | 436K | |
![[SND]](/icons/sound2.gif) | GOLD-ED1.mp3 | 2016-08-12 15:23 | 315K | |
![[SND]](/icons/sound2.gif) | GREENLANE1.mp3 | 2016-08-12 15:23 | 358K | |
![[IMG]](/icons/image2.gif) | Glencrutchery road copyright google.bmp | 2016-08-12 15:23 | 1.0M | |
![[SND]](/icons/sound2.gif) | HALL-KIDS1.mp3 | 2016-08-12 15:23 | 394K | |
![[SND]](/icons/sound2.gif) | HA MIN IIP STATUS 1.mp3 | 2016-08-12 15:23 | 206K | |
![[SND]](/icons/sound2.gif) | HARBOURJUMPING.mp3 | 2016-08-12 15:23 | 425K | |
![[SND]](/icons/sound2.gif) | HARRISON HONOUR 1.mp3 | 2016-08-12 15:23 | 232K | |
![[SND]](/icons/sound2.gif) | HEDGEHOGS 1.mp3 | 2016-08-12 15:23 | 344K | |
![[SND]](/icons/sound2.gif) | HERITAGE APP 2.mp3 | 2016-08-12 15:23 | 202K | |
![[SND]](/icons/sound2.gif) | HICKMAN EXCITED TT 1.mp3 | 2016-08-12 15:23 | 201K | |
![[SND]](/icons/sound2.gif) | HOMESTAY1.mp3 | 2016-08-12 15:23 | 395K | |
![[SND]](/icons/sound2.gif) | HUEWAI1.mp3 | 2016-08-12 15:23 | 404K | |
![[SND]](/icons/sound2.gif) | HULME2.mp3 | 2016-08-12 15:23 | 296K | |
![[SND]](/icons/sound2.gif) | Hartley Elder.mp3 | 2016-08-12 15:23 | 472K | |
![[SND]](/icons/sound2.gif) | IDC 1.mp3 | 2016-08-12 15:23 | 438K | |
![[SND]](/icons/sound2.gif) | IOC EWAN 1 .mp3 | 2016-08-12 15:23 | 391K | |
![[SND]](/icons/sound2.gif) | Irving.mp3 | 2016-08-12 15:24 | 364K | |
![[SND]](/icons/sound2.gif) | JOCK-END2END1.mp3 | 2016-08-12 15:24 | 426K | |
![[SND]](/icons/sound2.gif) | JONES TTLAUNCH 1.mp3 | 2016-08-12 15:24 | 456K | |
![[SND]](/icons/sound2.gif) | JULIET HOLT COMMONWEALTH GAMES.mp3 | 2016-08-12 15:24 | 440K | |
![[SND]](/icons/sound2.gif) | John Gill.mp3 | 2016-08-12 15:24 | 388K | |
![[SND]](/icons/sound2.gif) | Juan watterson crim justice 1.mp3 | 2016-08-12 15:24 | 403K | |
![[SND]](/icons/sound2.gif) | Juliet Games.mp3 | 2016-08-12 15:24 | 440K | |
![[SND]](/icons/sound2.gif) | KARRAN2 - (Imported).mp3 | 2016-08-12 15:24 | 401K | |
![[SND]](/icons/sound2.gif) | KENNY CARDIFFAIRWAY 1.mp3 | 2016-08-12 15:24 | 350K | |
![[SND]](/icons/sound2.gif) | KERM-DIVORCE.mp3 | 2016-08-12 15:24 | 444K | |
![[SND]](/icons/sound2.gif) | KERMODE1.mp3 | 2016-08-12 15:24 | 500K | |
![[SND]](/icons/sound2.gif) | KIDTESTS1.mp3 | 2016-08-12 15:24 | 401K | |
![[SND]](/icons/sound2.gif) | KINVIG-FIRE1.mp3 | 2016-08-12 15:24 | 382K | |
![[IMG]](/icons/image2.gif) | KNOCKUSKEY (___k).tiff | 2016-08-12 15:24 | 242K | |
![[IMG]](/icons/image2.gif) | Kirk Michael bank.bmp | 2016-08-12 15:24 | 553K | |
![[SND]](/icons/sound2.gif) | LEGAL AID 2.mp3 | 2016-08-12 15:24 | 339K | |
![[SND]](/icons/sound2.gif) | LIFEBOAT SUMMER FIGURES.mp3 | 2016-08-12 15:24 | 479K | |
![[SND]](/icons/sound2.gif) | LIVINGHOPE1.mp3 | 2016-08-12 15:24 | 400K | |
![[SND]](/icons/sound2.gif) | LOCAL ELECTIONS 2.mp3 | 2016-08-12 15:24 | 316K | |
![[IMG]](/icons/image2.gif) | Lifeboat floating man.BMP | 2016-08-12 15:24 | 1.3M | |
![[SND]](/icons/sound2.gif) | MAK HIGGINS - (Imported).mp3 | 2016-08-12 15:24 | 313K | |
![[SND]](/icons/sound2.gif) | MALARKY WOMEN 1 .mp3 | 2016-08-12 15:24 | 352K | |
![[SND]](/icons/sound2.gif) | MANSFIELD CRUELTY 1.mp3 | 2016-08-12 15:24 | 457K | |
![[SND]](/icons/sound2.gif) | MARC SAME SEX MARRIAGE HISTORY 2.mp3 | 2016-08-12 15:24 | 206K | |
![[SND]](/icons/sound2.gif) | MARTYN QUAYLE BENEFITS (2) - (Imported).mp3 | 2016-08-12 15:24 | 244K | |
![[IMG]](/icons/image2.gif) | MBE.bmp | 2016-08-12 15:24 | 214K | |
![[SND]](/icons/sound2.gif) | MCEDWARDS HEALTH SURVEY.mp3 | 2016-08-12 15:24 | 386K | |
![[SND]](/icons/sound2.gif) | MON - MICROGAMING SOAPBOX PART 2.mp3 | 2016-08-12 15:24 | 215K | |
![[ ]](/icons/unknown.gif) | Mannifest Ram - credit manxscenes.com | 2016-08-12 15:25 | 122K | |
![[IMG]](/icons/image2.gif) | Matrix sign hilberry road.BMP | 2016-08-12 15:25 | 223K | |
![[SND]](/icons/sound2.gif) | McKinley-JobsFair.mp3 | 2016-08-12 15:25 | 467K | |
![[SND]](/icons/sound2.gif) | Michael BELL.MP3 | 2016-08-12 15:25 | 327K | |
![[SND]](/icons/sound2.gif) | Mike Radcliffe.mp3 | 2016-08-12 15:25 | 284K | |
![[IMG]](/icons/image2.gif) | Mobile-Phones.bmp | 2016-08-12 15:25 | 703K | |
![[SND]](/icons/sound2.gif) | NEWEY BURGLARY PREV 2.mp3 | 2016-08-12 15:25 | 243K | |
![[SND]](/icons/sound2.gif) | NURSERECRUITMENT1.mp3 | 2016-08-12 15:25 | 1.1M | |
![[SND]](/icons/sound2.gif) | NormanKneen-SelfCare.mp3 | 2016-08-12 15:25 | 466K | |
![[SND]](/icons/sound2.gif) | O'NEILL DOUGLAS EAST 1.mp3 | 2016-08-12 15:25 | 295K | |
![[SND]](/icons/sound2.gif) | ORGAN DONATION GARDEN 2.mp3 | 2016-08-12 15:25 | 168K | |
![[SND]](/icons/sound2.gif) | OSCAR1.mp3 | 2016-08-12 15:25 | 371K | |
![[SND]](/icons/sound2.gif) | PC scott nails cut.mp3 | 2016-08-12 15:25 | 246K | |
![[SND]](/icons/sound2.gif) | PEARSON CAR CHECKS.mp3 | 2016-08-12 15:25 | 397K | |
![[SND]](/icons/sound2.gif) | PENSIONS1.mp3 | 2016-08-12 15:25 | 420K | |
![[SND]](/icons/sound2.gif) | PHARMACY 1.mp3 | 2016-08-12 15:25 | 222K | |
![[SND]](/icons/sound2.gif) | PINE5.mp3 | 2016-08-12 15:25 | 483K | |
![[SND]](/icons/sound2.gif) | PORTER SAMARITANS EXAM HELP 1.mp3 | 2016-08-18 06:39 | 501K | |
![[SND]](/icons/sound2.gif) | Paul Criane .mp3 | 2016-08-12 15:25 | 420K | |
![[SND]](/icons/sound2.gif) | Paul Moncaster Thursday .mp3 | 2016-08-12 15:25 | 298K | |
![[IMG]](/icons/image2.gif) | Peel breakwater.bmp | 2016-08-12 15:25 | 816K | |
![[SND]](/icons/sound2.gif) | Pendlebury Saturday.mp3 | 2016-08-12 15:25 | 375K | |
![[IMG]](/icons/image2.gif) | Port Erin marine lab.bmp | 2016-08-12 15:25 | 793K | |
![[IMG]](/icons/image2.gif) | Proof of age.bmp | 2016-08-12 15:26 | 249K | |
![[SND]](/icons/sound2.gif) | QUAYLE DISABILITY 1.mp3 | 2016-08-12 15:26 | 326K | |
![[ ]](/icons/unknown.gif) | Quarterbridge Crash Nov 15.jpg-large | 2016-08-12 15:26 | 118K | |
![[VID]](/icons/movie.gif) | RAF helicopter takes off from Peel Beach after rescue.MOV | 2016-08-12 15:26 | 2.9M | |
![[SND]](/icons/sound2.gif) | RAILWAYS CUBBON 1.mp3 | 2016-08-12 15:26 | 405K | |
![[SND]](/icons/sound2.gif) | RALLY 2014 1.mp3 | 2016-08-12 15:26 | 282K | |
![[SND]](/icons/sound2.gif) | RECRUITS MIXDOWN.mp3 | 2016-08-12 15:26 | 1.0M | |
![[SND]](/icons/sound2.gif) | RESCUE 1.mp3 | 2016-08-12 15:26 | 309K | |
![[SND]](/icons/sound2.gif) | RICHARD PEARSON ECONOMY - (Imported).mp3 | 2016-08-12 15:26 | 182K | |
![[SND]](/icons/sound2.gif) | RICK STEIN MARATHON 1.mp3 | 2016-08-12 15:26 | 316K | |
![[SND]](/icons/sound2.gif) | RONAN RETAIL 1 (1).mp3 | 2016-08-12 15:26 | 386K | |
![[SND]](/icons/sound2.gif) | ROY REDMAYNE - (Imported).mp3 | 2016-08-12 15:26 | 311K | |
![[SND]](/icons/sound2.gif) | RUSHEN HERITAGE 1.mp3 | 2016-08-12 15:26 | 178K | |
![[IMG]](/icons/image2.gif) | Rally isle of man logo.bmp | 2016-08-12 15:26 | 49K | |
![[SND]](/icons/sound2.gif) | SALTER - (Imported).mp3 | 2016-08-12 15:26 | 324K | |
![[SND]](/icons/sound2.gif) | SALTERPART1 - (Imported).mp3 | 2016-08-12 15:26 | 457K | |
![[SND]](/icons/sound2.gif) | SAT - TINATHON.mp3 | 2016-08-12 15:26 | 407K | |
![[SND]](/icons/sound2.gif) | SKELLY COVERAGE 1.mp3 | 2016-08-12 15:26 | 329K | |
![[SND]](/icons/sound2.gif) | SKELLY MARINE BIO 1.mp3 | 2016-08-12 15:26 | 432K | |
![[SND]](/icons/sound2.gif) | SKELLY OFFERING 2.mp3 | 2016-08-12 15:26 | 125K | |
![[SND]](/icons/sound2.gif) | SKELLY ROAD 2.mp3 | 2016-08-12 15:26 | 338K | |
![[SND]](/icons/sound2.gif) | SPOOKS REANEY 1 .mp3 | 2016-08-12 15:26 | 409K | |
![[SND]](/icons/sound2.gif) | STUART JAQUES CATTLE DEATHS.mp3 | 2016-08-12 15:26 | 446K | |
![[SND]](/icons/sound2.gif) | SUNDAYPARKING1.mp3 | 2016-08-12 15:26 | 414K | |
![[ ]](/icons/unknown.gif) | Saga Rose Cruise Ship | 2016-08-12 15:26 | 1.9M | |
![[ ]](/icons/unknown.gif) | Simon Lowe DepressionEvent.jpg-large | 2016-08-12 15:26 | 93K | |
![[SND]](/icons/sound2.gif) | TABB XMAS 1.mp3 | 2016-08-12 15:27 | 363K | |
![[SND]](/icons/sound2.gif) | T BIRCHALL SIDECAR 1.mp3 | 2016-08-12 15:27 | 457K | |
![[SND]](/icons/sound2.gif) | TEARE-FACTS2.mp3 | 2016-08-12 15:27 | 371K | |
![[SND]](/icons/sound2.gif) | THOMAS HANSARD 2.mp3 | 2016-08-12 15:27 | 409K | |
![[SND]](/icons/sound2.gif) | TT VOX.mp3 | 2016-08-12 15:27 | 418K | |
![[SND]](/icons/sound2.gif) | TUES - BIZ - EMMA ALLARD ZERO HOUR CONTRACTS.mp3 | 2016-08-12 15:27 | 448K | |
![[SND]](/icons/sound2.gif) | TUNISIA TRAVEL INSURANCE 2.mp3 | 2016-08-12 15:27 | 202K | |
![[SND]](/icons/sound2.gif) | Tim Kennaugh reaction.mp3 | 2016-08-12 15:27 | 225K | |
![[SND]](/icons/sound2.gif) | VEHICLEDUTY.mp3 | 2016-08-12 15:27 | 362K | |
![[SND]](/icons/sound2.gif) | VORSTER LEE EVENT 1.mp3 | 2016-08-12 15:27 | 274K | |
![[SND]](/icons/sound2.gif) | Vehicle Scam.mp3 | 2016-08-12 15:27 | 459K | |
![[SND]](/icons/sound2.gif) | WALK TALK 1 .mp3 | 2016-08-12 15:27 | 213K | |
![[SND]](/icons/sound2.gif) | WATTERSON-PRISON1.mp3 | 2016-08-12 15:27 | 412K | |
![[SND]](/icons/sound2.gif) | WATTERSON ARMEDFORCES 1.mp3 | 2016-08-12 15:27 | 333K | |
![[SND]](/icons/sound2.gif) | WATTERSON COMMITTEE 1.mp3 | 2016-08-12 15:27 | 416K | |
![[SND]](/icons/sound2.gif) | WATTERSON DRUGS - (Imported).mp3 | 2016-08-12 15:27 | 408K | |
![[SND]](/icons/sound2.gif) | WATTERSON SEXTS 1.mp3 | 2016-08-12 15:27 | 415K | |
![[SND]](/icons/sound2.gif) | WED - ANDREAS SCHOOL AWARD.mp3 | 2016-08-12 15:27 | 269K | |
![[SND]](/icons/sound2.gif) | WED - BIZ - ALICE BOWS-LARKIN 2.mp3 | 2016-08-12 15:27 | 251K | |
![[SND]](/icons/sound2.gif) | WED POST OFFICE.mp3 | 2016-08-12 15:27 | 270K | |
![[SND]](/icons/sound2.gif) | WETTEST JUNE - (Imported).mp3 | 2016-08-12 15:27 | 467K | |
![[SND]](/icons/sound2.gif) | YOUNGDRIVERS1.mp3 | 2016-08-12 15:27 | 375K | |
![[IMG]](/icons/image2.gif) | adam wood.bmp | 2016-08-12 15:27 | 100K | |
![[IMG]](/icons/image2.gif) | alex downie.bmp | 2016-08-12 15:27 | 1.0M | |
![[SND]](/icons/sound2.gif) | allan bell civil granada web.mp3 | 2016-08-12 15:27 | 411K | |
![[IMG]](/icons/image2.gif) | arrivals board.bmp | 2016-08-12 15:27 | 590K | |
![[SND]](/icons/sound2.gif) | baines verdict.mp3 | 2016-08-12 15:27 | 666K | |
![[SND]](/icons/sound2.gif) | bill henderson privatisation cut.mp3 | 2016-08-12 15:28 | 370K | |
![[SND]](/icons/sound2.gif) | bobby morton (cut.mp3 | 2016-08-12 15:28 | 286K | |
![[IMG]](/icons/image2.gif) | bounced irving cheque.bmp | 2016-08-12 15:28 | 940K | |
![[SND]](/icons/sound2.gif) | brexit-quayle.mp3 | 2017-10-04 12:01 | 731K | |
![[IMG]](/icons/image2.gif) | bus.bmp | 2016-08-12 15:28 | 2.0M | |
![[SND]](/icons/sound2.gif) | cannan attribution.mp3 | 2016-08-12 15:28 | 327K | |
![[SND]](/icons/sound2.gif) | change-quayle.mp3 | 2016-11-18 09:23 | 762K | |
![[SND]](/icons/sound2.gif) | cheif Minister restructure.mp3 | 2016-08-12 15:28 | 346K | |
![[SND]](/icons/sound2.gif) | chief min foi web.mp3 | 2016-08-12 15:28 | 462K | |
![[SND]](/icons/sound2.gif) | colin kniveton.mp3 | 2016-08-12 15:28 | 3.0M | |
![[IMG]](/icons/image2.gif) | constituency map.bmp | 2016-08-12 15:28 | 3.8M | |
![[SND]](/icons/sound2.gif) | crash stephens web.mp3 | 2016-08-12 15:29 | 276K | |
![[IMG]](/icons/image2.gif) | credit cards.bmp | 2016-08-12 15:29 | 481K | |
![[SND]](/icons/sound2.gif) | cretney-stevie.mp3 | 2016-08-12 15:29 | 407K | |
![[SND]](/icons/sound2.gif) | cycling-callister.mp3 | 2017-01-19 13:34 | 386K | |
![[SND]](/icons/sound2.gif) | cycling-royle.mp3 | 2017-01-19 13:34 | 670K | |
![[IMG]](/icons/image2.gif) | dandara.bmp | 2016-08-12 15:29 | 77K | |
![[SND]](/icons/sound2.gif) | david-cretney-response.mp3 | 2016-08-12 15:29 | 385K | |
![[IMG]](/icons/image2.gif) | david ashford.bmp | 2016-08-12 15:29 | 265K | |
![[SND]](/icons/sound2.gif) | david cretney web.mp3 | 2016-08-12 15:29 | 233K | |
![[IMG]](/icons/image2.gif) | douglas town hall.bmp | 2016-08-12 15:29 | 576K | |
![[IMG]](/icons/image2.gif) | easyjet.bmp | 2016-08-12 15:29 | 1.6M | |
![[IMG]](/icons/image2.gif) | electric car.bmp | 2016-08-12 15:29 | 1.4M | |
![[SND]](/icons/sound2.gif) | ellanvannin-blackburn.mp3 | 2018-06-05 12:16 | 1.2M | |
![[IMG]](/icons/image2.gif) | fostercity.bmp | 2016-08-12 15:29 | 509K | |
![[IMG]](/icons/image2.gif) | frost mountain.bmp | 2016-08-12 15:29 | 826K | |
![[IMG]](/icons/image2.gif) | glenfaba candidates.bmp | 2016-08-12 15:30 | 364K | |
![[SND]](/icons/sound2.gif) | gordon edwards mobiles web.mp3 | 2016-08-12 15:30 | 322K | |
![[SND]](/icons/sound2.gif) | governor tynwald (2).mp3 | 2016-08-12 15:30 | 555K | |
![[SND]](/icons/sound2.gif) | graham crowe cut1.mp3 | 2016-08-12 15:30 | 313K | |
![[SND]](/icons/sound2.gif) | graham shimmin.mp3 | 2016-08-12 15:30 | 363K | |
![[IMG]](/icons/image2.gif) | grit bin.bmp | 2016-08-12 15:30 | 884K | |
![[IMG]](/icons/image2.gif) | guernsey flag.bmp | 2016-08-12 15:30 | 576K | |
![[IMG]](/icons/image2.gif) | http---www.tynwald.org.im-tynwald-biographies-bell-ar.pdf - Adobe Reader.bmp | 2016-08-12 15:30 | 397K | |
![[IMG]](/icons/image2.gif) | infrastructure logo.bmp | 2016-08-12 15:30 | 56K | |
![[IMG]](/icons/image2.gif) | jake.tif | 2016-08-12 15:30 | 709K | |
![[SND]](/icons/sound2.gif) | jamie irving streetheritage.mp3 | 2016-08-12 15:30 | 369K | |
![[IMG]](/icons/image2.gif) | kate beecroft.bmp | 2016-08-12 15:30 | 576K | |
![[IMG]](/icons/image2.gif) | kennaugh and swift.bmp | 2016-08-12 15:30 | 447K | |
![[SND]](/icons/sound2.gif) | kevin williams friday.mp3 | 2016-08-12 15:30 | 148K | |
![[IMG]](/icons/image2.gif) | ksf youtube.bmp | 2016-08-12 15:30 | 1.0M | |
![[IMG]](/icons/image2.gif) | lifeboat rescue.bmp | 2016-08-12 15:30 | 2.0M | |
![[ ]](/icons/layout.gif) | lonan houses.pdf | 2016-11-18 13:36 | 1.3M | |
![[TXT]](/icons/text.gif) | lost rocket.htm | 2016-08-12 15:30 | 1.8M | |
![[SND]](/icons/sound2.gif) | macca urban sports web.mp3 | 2016-08-12 15:31 | 276K | |
![[ ]](/icons/unknown.gif) | mannifest sheep - credit manxscenes.com | 2016-08-12 15:31 | 122K | |
![[IMG]](/icons/image2.gif) | manx2 crash ronaldsway.bmp | 2016-08-12 15:31 | 5.7M | |
![[IMG]](/icons/image2.gif) | manx gas.bmp | 2016-08-12 15:31 | 36K | |
![[IMG]](/icons/image2.gif) | manx gas2.bmp | 2016-08-12 15:31 | 868K | |
![[IMG]](/icons/image2.gif) | map.bmp | 2016-08-12 15:31 | 175K | |
![[IMG]](/icons/image2.gif) | martin nielson.bmp | 2016-08-12 15:31 | 857K | |
![[IMG]](/icons/image2.gif) | mephedrone campgin.bmp | 2016-08-12 15:31 | 754K | |
![[IMG]](/icons/image2.gif) | mountain dec 10.bmp | 2016-08-12 15:31 | 598K | |
![[IMG]](/icons/image2.gif) | mountain road 301110.bmp | 2016-08-12 15:31 | 668K | |
![[IMG]](/icons/image2.gif) | park road.bmp | 2016-08-12 15:31 | 703K | |
![[SND]](/icons/sound2.gif) | paula .mp3 | 2016-08-12 15:31 | 300K | |
![[IMG]](/icons/image2.gif) | peel graffiti1.bmp | 2016-08-12 15:32 | 791K | |
![[IMG]](/icons/image2.gif) | peel graffiti2.bmp | 2016-08-12 15:32 | 791K | |
![[IMG]](/icons/image2.gif) | petrol pump.bmp | 2016-08-12 15:32 | 596K | |
![[ ]](/icons/unknown.gif) | power station.jpg-large | 2017-03-02 13:07 | 113K | |
![[IMG]](/icons/image2.gif) | prospect president.bmp | 2016-08-12 15:32 | 2.3M | |
![[IMG]](/icons/image2.gif) | race sun.bmp | 2016-08-12 15:32 | 479K | |
![[IMG]](/icons/image2.gif) | rally iom logo.bmp | 2016-08-12 15:32 | 900K | |
![[ ]](/icons/unknown.gif) | ramsey polling card.ashx | 2016-08-12 15:32 | 54K | |
![[SND]](/icons/sound2.gif) | ray cox parish deadline.mp3 | 2016-08-12 15:32 | 366K | |
![[IMG]](/icons/image2.gif) | recip health letter.bmp | 2016-08-12 15:32 | 11M | |
![[SND]](/icons/sound2.gif) | robertshaw conf (2).mp3 | 2016-08-12 15:32 | 323K | |
![[SND]](/icons/sound2.gif) | rodan cm.mp3 | 2016-08-12 15:32 | 408K | |
![[SND]](/icons/sound2.gif) | shimmin cut.mp3 | 2016-08-12 15:32 | 199K | |
![[IMG]](/icons/image2.gif) | simon paul leece.bmp | 2016-08-12 15:33 | 844K | |
![[IMG]](/icons/image2.gif) | smart car.bmp | 2016-08-12 15:33 | 576K | |
![[IMG]](/icons/image2.gif) | snow nov10.bmp | 2016-08-12 15:33 | 631K | |
![[IMG]](/icons/image2.gif) | sport relief logo.bmp | 2016-08-12 15:33 | 4.1M | |
![[IMG]](/icons/image2.gif) | sports awards.bmp | 2016-08-12 15:33 | 552K | |
![[SND]](/icons/sound2.gif) | statue-owens.mp3 | 2016-09-21 08:18 | 406K | |
![[IMG]](/icons/image2.gif) | stolen bike.bmp | 2016-08-12 15:33 | 2.0M | |
![[IMG]](/icons/image2.gif) | stott murray.bmp | 2016-08-12 15:33 | 844K | |
![[IMG]](/icons/image2.gif) | suspect1.bmp | 2016-08-12 15:33 | 184K | |
![[IMG]](/icons/image2.gif) | suspect2.bmp | 2016-08-12 15:33 | 228K | |
![[IMG]](/icons/image2.gif) | suspect3.bmp | 2016-08-12 15:33 | 202K | |
![[IMG]](/icons/image2.gif) | swimming logo.bmp | 2016-08-12 15:33 | 576K | |
![[TXT]](/icons/text.gif) | telecoms 2.htm | 2016-08-12 15:33 | 446 | |
![[IMG]](/icons/image2.gif) | tv licence.bmp | 2016-08-12 15:33 | 576K | |
![[TXT]](/icons/text.gif) | twitter.htm | 2016-08-12 15:33 | 26K | |
![[IMG]](/icons/image2.gif) | twitter logo.bmp | 2016-08-12 15:33 | 192K | |
![[SND]](/icons/sound2.gif) | upsdell breast.mp3 | 2016-08-12 15:33 | 177K | |
![[IMG]](/icons/image2.gif) | waste.bmp | 2016-08-12 15:33 | 69K | |
![[ ]](/icons/unknown.gif) | water works.jpg-large | 2016-09-12 08:13 | 51K | |
![[IMG]](/icons/image2.gif) | william stamps.bmp | 2016-08-12 15:33 | 1.3M | |
![[IMG]](/icons/image2.gif) | will sutton.bmp | 2016-08-12 15:33 | 616K | |
![[IMG]](/icons/image2.gif) | wirral webcam.bmp | 2016-08-12 15:34 | 873K | |
![[IMG]](/icons/image2.gif) | woodward.bmp | 2016-08-12 15:34 | 1.1M | |
|